![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Arch 535 Elements of Structure.pdf | 2019-11-25 15:48 | 36M | |
| Arch 535 Elements of Structure.pptx | 2018-04-03 19:23 | 25M | |
| TheEssentialMathematicsForComputationalDesign_4thEdition2019.doc.pdf | 2019-06-06 11:56 | 5.2M | |
| citicorp_tower.mp3 | 2015-11-30 09:37 | 23M | |
| equations.pdf | 2019-11-26 11:51 | 1.2M | |
| hw01.pdf | 2019-08-26 13:33 | 124K | |
| hw02.pdf | 2019-09-05 20:21 | 402K | |
| hw03.pdf | 2019-09-12 14:00 | 133K | |
| hw04.pdf | 2019-09-19 14:51 | 301K | |
| hw05.pdf | 2019-09-26 14:45 | 342K | |
| hw06.pdf | 2019-10-09 10:16 | 275K | |
| hw07.pdf | 2019-10-17 10:44 | 264K | |
| hw08.pdf | 2019-10-24 12:11 | 174K | |
| hw09.pdf | 2019-11-01 18:00 | 1.0M | |
| hw10.pdf | 2019-11-07 14:07 | 1.5M | |
| hw11.pdf | 2019-11-15 10:20 | 287K | |
| oldexams/ | 2019-12-23 13:19 | - | |
| pexam.pdf | 2019-11-27 17:56 | 545K | |
| pexam_solns.pdf | 2019-12-10 13:49 | 819K | |
| phys8_notes_20190828.pdf | 2019-08-28 11:12 | 48M | |
| phys8_notes_20190830.pdf | 2019-08-30 13:12 | 467K | |
| phys8_notes_20190904.pdf | 2019-09-04 13:06 | 1.7M | |
| phys8_notes_20190906.pdf | 2019-09-06 10:22 | 1.1M | |
| phys8_notes_20190909.pdf | 2019-09-09 11:23 | 850K | |
| phys8_notes_20190911.pdf | 2019-09-11 10:30 | 618K | |
| phys8_notes_20190913.pdf | 2019-09-13 11:39 | 785K | |
| phys8_notes_20190916.pdf | 2019-09-16 13:05 | 603K | |
| phys8_notes_20190918.pdf | 2019-09-18 13:42 | 6.9M | |
| phys8_notes_20190920.pdf | 2019-09-20 14:01 | 6.6M | |
| phys8_notes_20190923.pdf | 2019-09-23 10:10 | 6.5M | |
| phys8_notes_20190925.pdf | 2019-09-25 14:00 | 2.7M | |
| phys8_notes_20190927.pdf | 2019-09-27 15:09 | 9.7M | |
| phys8_notes_20190930.pdf | 2019-09-30 13:07 | 6.7M | |
| phys8_notes_20191002.pdf | 2019-10-02 14:57 | 307K | |
| phys8_notes_20191004.pdf | 2019-10-04 13:58 | 5.0M | |
| phys8_notes_20191007.pdf | 2019-10-07 15:05 | 1.5M | |
| phys8_notes_20191009.pdf | 2019-10-09 14:10 | 1.0M | |
| phys8_notes_20191014.pdf | 2019-10-14 15:05 | 1.0M | |
| phys8_notes_20191016.pdf | 2019-10-16 16:40 | 1.3M | |
| phys8_notes_20191018.pdf | 2019-10-18 14:17 | 956K | |
| phys8_notes_20191021.pdf | 2019-10-23 10:13 | 911K | |
| phys8_notes_20191023.pdf | 2019-10-23 11:33 | 1.7M | |
| phys8_notes_20191025.pdf | 2019-10-25 14:55 | 1.6M | |
| phys8_notes_20191028.pdf | 2019-10-28 13:53 | 5.5M | |
| phys8_notes_20191030.pdf | 2019-10-30 11:14 | 4.6M | |
| phys8_notes_20191101.pdf | 2019-11-01 11:13 | 3.3M | |
| phys8_notes_20191104.pdf | 2019-11-04 13:56 | 2.6M | |
| phys8_notes_20191106.pdf | 2019-11-06 13:12 | 8.4M | |
| phys8_notes_20191108.pdf | 2019-11-08 10:35 | 7.1M | |
| phys8_notes_20191111.pdf | 2019-11-11 13:56 | 5.7M | |
| phys8_notes_20191113.pdf | 2019-11-13 10:14 | 10M | |
| phys8_notes_20191115.pdf | 2019-11-15 16:18 | 7.9M | |
| phys8_notes_20191118.pdf | 2019-11-18 11:04 | 10M | |
| phys8_notes_20191120.pdf | 2019-11-20 11:42 | 5.5M | |
| phys8_notes_20191122.pdf | 2019-11-22 14:31 | 4.7M | |
| phys8_notes_20191125.pdf | 2019-11-25 15:34 | 3.9M | |
| phys8_notes_20191127.pdf | 2019-11-27 10:22 | 1.5M | |
| phys8_notes_20191202.pdf | 2019-12-02 11:32 | 971K | |
| phys8_notes_20191204.pdf | 2019-12-04 11:28 | 908K | |
| phys8_notes_20191206.pdf | 2019-12-06 14:45 | 1.0M | |
| phys8_notes_20191209.pdf | 2019-12-09 17:48 | 56M | |
| pyprocessing/ | 2018-11-21 13:14 | - | |
| reading_20200909.pdf | 2020-09-02 12:32 | 174K | |
| syllabus.pdf | 2019-08-22 14:16 | 51K | |