![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| phys8_slides.pdf | 2021-08-10 08:14 | 119M | |
| phys8_slides_dark.pdf | 2021-08-10 18:06 | 119M | |
| phys8_notes_20191209.pdf | 2019-12-09 17:48 | 56M | |
| phys8_slides_01.pdf | 2021-08-30 13:12 | 48M | |
| phys8_notes_20190828.pdf | 2019-08-28 11:12 | 48M | |
| Arch 535 Elements of Structure.pdf | 2019-11-25 15:48 | 36M | |
| Arch 535 Elements of Structure.pptx | 2018-04-03 19:23 | 25M | |
| citicorp_tower.mp3 | 2015-11-30 09:37 | 23M | |
| phys8_notes_20211206.pdf | 2021-12-06 18:06 | 20M | |
| physics008_wales_2009.pdf | 2011-05-06 17:26 | 17M | |
| phys8_slides_14.pdf | 2021-11-24 10:34 | 13M | |
| phys8_slides_10.pdf | 2021-10-12 10:29 | 12M | |
| phys8_slides_08.pdf | 2021-09-26 17:59 | 11M | |
| phys8_notes_20191113.pdf | 2019-11-13 10:14 | 10M | |
| phys8_notes_20191118.pdf | 2019-11-18 11:04 | 10M | |
| phys8_notes_20190927.pdf | 2019-09-27 15:09 | 9.7M | |
| phys8_notes_20191106.pdf | 2019-11-06 13:12 | 8.4M | |
| phys8_notes_20191115.pdf | 2019-11-15 16:18 | 7.9M | |
| phys8_slides_13.pdf | 2021-11-15 08:25 | 7.2M | |
| phys8_notes_20191108.pdf | 2019-11-08 10:35 | 7.1M | |
| phys8_notes_20210901.pdf | 2021-09-03 14:28 | 7.1M | |
| phys8_notes_20190918.pdf | 2019-09-18 13:42 | 6.9M | |
| phys8_notes_20190930.pdf | 2019-09-30 13:07 | 6.7M | |
| phys8_notes_20190920.pdf | 2019-09-20 14:01 | 6.6M | |
| phys8_notes_20190923.pdf | 2019-09-23 10:10 | 6.5M | |
| phys8_notes_20191111.pdf | 2019-11-11 13:56 | 5.7M | |
| phys8_notes_20191120.pdf | 2019-11-20 11:42 | 5.5M | |
| phys8_notes_20191028.pdf | 2019-10-28 13:53 | 5.5M | |
| TheEssentialMathematicsForComputationalDesign_4thEdition2019.doc.pdf | 2019-06-06 11:56 | 5.2M | |
| phys8_notes_20191004.pdf | 2019-10-04 13:58 | 5.0M | |
| phys8_notes_20191122.pdf | 2019-11-22 14:31 | 4.7M | |
| phys8_notes_20191030.pdf | 2019-10-30 11:14 | 4.6M | |
| phys8_slides_12.pdf | 2021-11-04 17:42 | 4.5M | |
| phys8_slides_09.pdf | 2021-10-01 11:38 | 4.4M | |
| phys8_notes_20191125.pdf | 2019-11-25 15:34 | 3.9M | |
| phys8_notes_20211208.pdf | 2021-12-08 14:42 | 3.7M | |
| phys8_notes_20191101.pdf | 2019-11-01 11:13 | 3.3M | |
| phys8_slides_11.pdf | 2021-10-18 08:05 | 3.0M | |
| phys8_notes_20190925.pdf | 2019-09-25 14:00 | 2.7M | |
| phys8_notes_20191104.pdf | 2019-11-04 13:56 | 2.6M | |
| phys8_slides_03.pdf | 2021-09-06 09:22 | 1.8M | |
| phys8_notes_20211122.pdf | 2021-11-22 15:01 | 1.7M | |
| phys8_notes_20191023.pdf | 2019-10-23 11:33 | 1.7M | |
| phys8_notes_20190904.pdf | 2019-09-04 13:06 | 1.7M | |
| phys8_notes_20191025.pdf | 2019-10-25 14:55 | 1.6M | |
| phys8_notes_20191007.pdf | 2019-10-07 15:05 | 1.5M | |
| hw10.pdf | 2019-11-07 14:07 | 1.5M | |
| phys8_notes_20191127.pdf | 2019-11-27 10:22 | 1.5M | |
| phys8_notes_20211129.pdf | 2021-11-29 15:09 | 1.5M | |
| ws24.pdf | 2021-11-29 17:45 | 1.4M | |
| phys8_notes_20191016.pdf | 2019-10-16 16:40 | 1.3M | |
| equations.pdf | 2021-11-11 16:35 | 1.2M | |
| phys8_notes_20190906.pdf | 2019-09-06 10:22 | 1.1M | |
| phys8_notes_20191206.pdf | 2019-12-06 14:45 | 1.0M | |
| hw09.pdf | 2019-11-01 18:00 | 1.0M | |
| exam2021.pdf | 2021-12-03 09:53 | 1.0M | |
| phys8_notes_20191014.pdf | 2019-10-14 15:05 | 1.0M | |
| phys8_notes_20191009.pdf | 2019-10-09 14:10 | 1.0M | |
| phys8_notes_20191202.pdf | 2019-12-02 11:32 | 971K | |
| phys8_notes_20191018.pdf | 2019-10-18 14:17 | 956K | |
| phys8_notes_20210913.pdf | 2021-09-13 14:41 | 953K | |
| phys8_notes_20191021.pdf | 2019-10-23 10:13 | 911K | |
| phys8_notes_20191204.pdf | 2019-12-04 11:28 | 908K | |
| phys8_notes_20190909.pdf | 2019-09-09 11:23 | 850K | |
| pexam_solns.pdf | 2019-12-10 13:49 | 819K | |
| phys8_notes_20190913.pdf | 2019-09-13 11:39 | 785K | |
| ws25.pdf | 2021-12-01 14:25 | 776K | |
| phys8_slides_04.pdf | 2021-09-09 11:38 | 739K | |
| phys8_slides_05.pdf | 2021-09-14 18:24 | 731K | |
| phys8_notes_20190911.pdf | 2019-09-11 10:30 | 618K | |
| phys8_notes_20190916.pdf | 2019-09-16 13:05 | 603K | |
| phys8_slides_06.pdf | 2021-09-19 14:54 | 600K | |
| 3n1h_map.png | 2021-08-27 15:30 | 598K | |
| pexam.pdf | 2019-11-27 17:56 | 545K | |
| phys8_notes_20210915.pdf | 2021-09-15 16:12 | 531K | |
| phys8_notes_20211110.pdf | 2021-11-10 14:47 | 500K | |
| 0920_train1.png | 2017-09-20 11:19 | 493K | |
| phys8_slides_02.pdf | 2021-08-30 13:12 | 478K | |
| phys8_notes_20190830.pdf | 2019-08-30 13:12 | 467K | |
| ws23.pdf | 2021-11-22 11:11 | 466K | |
| ws20.pdf | 2021-11-10 13:19 | 463K | |
| phys8_notes_20211115.pdf | 2021-11-15 14:25 | 463K | |
| ws21.pdf | 2021-11-15 13:10 | 442K | |
| phys8_slides_07.pdf | 2021-09-25 12:22 | 412K | |
| phys8_notes_20210908.pdf | 2021-09-08 12:47 | 406K | |
| 0830_plank_01.jpg | 2017-08-30 09:30 | 402K | |
| hw02.pdf | 2019-09-05 20:21 | 402K | |
| ws04.pdf | 2021-09-15 16:12 | 381K | |
| phys8_notes_20211108.pdf | 2021-11-08 13:03 | 380K | |
| phys8_notes_20211117.pdf | 2021-11-17 15:05 | 369K | |
| phys8_notes_20211201.pdf | 2021-12-01 15:09 | 354K | |
| 20210917.pdf | 2021-09-17 10:56 | 353K | |
| ws19.pdf | 2021-11-08 09:33 | 349K | |
| ws22.pdf | 2021-11-17 13:07 | 348K | |
| hw05.pdf | 2019-09-26 14:45 | 342K | |
| phys8_notes_20191002.pdf | 2019-10-02 14:57 | 307K | |
| hw04.pdf | 2019-09-19 14:51 | 301K | |
| hw11.pdf | 2019-11-15 10:20 | 287K | |
| phys8_notes_20211020.pdf | 2021-10-20 15:08 | 281K | |
| phys8_notes_20211011.pdf | 2021-10-11 15:03 | 277K | |
| hw06.pdf | 2019-10-09 10:16 | 275K | |
| hw07.pdf | 2019-10-17 10:44 | 264K | |
| ws14.pdf | 2021-10-20 13:21 | 260K | |
| ws11.pdf | 2021-10-11 14:10 | 255K | |
| 0923_twoblocks.png | 2015-09-23 11:06 | 202K | |
| phys8_notes_20211004.pdf | 2021-10-04 13:50 | 198K | |
| phys8_notes_20211027.pdf | 2021-10-27 15:03 | 197K | |
| phys8_notes_20211006.pdf | 2021-10-06 14:47 | 192K | |
| ws16.pdf | 2021-10-27 13:27 | 177K | |
| hw08.pdf | 2019-10-24 12:11 | 174K | |
| reading_20200909.pdf | 2020-09-02 12:32 | 174K | |
| ws18.pdf | 2021-11-03 14:22 | 173K | |
| phys8_notes_20210927.pdf | 2021-09-27 14:14 | 164K | |
| ws09.pdf | 2021-10-04 10:40 | 164K | |
| ws27.pdf | 2021-12-08 11:48 | 159K | |
| phys8_notes_20211025.pdf | 2021-10-25 14:34 | 150K | |
| ws07.pdf | 2021-09-22 19:09 | 148K | |
| phys8_notes_20210922.pdf | 2021-09-22 14:51 | 141K | |
| ws17.pdf | 2021-11-01 14:06 | 139K | |
| ws10.pdf | 2021-10-06 13:13 | 136K | |
| hw03.pdf | 2019-09-12 14:00 | 133K | |
| ws15.pdf | 2021-10-25 10:56 | 131K | |
| phys8_notes_20211013.pdf | 2021-10-13 15:01 | 128K | |
| phys8_notes_20210920.pdf | 2021-09-20 14:03 | 127K | |
| ws05.pdf | 2021-09-20 12:16 | 125K | |
| phys8_notes_20210929.pdf | 2021-09-29 13:33 | 124K | |
| hw01.pdf | 2019-08-26 13:33 | 124K | |
| ws02.pdf | 2021-09-02 17:09 | 119K | |
| ws03.pdf | 2021-09-13 11:39 | 111K | |
| ws12.pdf | 2021-10-13 13:41 | 108K | |
| ws06.pdf | 2021-09-22 10:51 | 102K | |
| phys8_notes_20211018.pdf | 2021-10-18 13:04 | 100K | |
| ws13.pdf | 2021-10-18 08:25 | 96K | |
| ws08.pdf | 2021-09-28 13:42 | 84K | |
| ws01.pdf | 2021-08-31 13:11 | 78K | |
| syllabus.pdf | 2021-12-29 09:57 | 55K | |
| syllabus_2021.pdf | 2021-03-03 14:18 | 55K | |
| 0920_cable.png | 2019-09-20 10:55 | 27K | |
| pyprocessing/ | 2021-03-03 14:19 | - | |
| oldexams/ | 2021-03-03 14:19 | - | |